C25H35N5 — CID 143595232
2-(4-cyclobutylpiperazin-1-yl)-7-[1-(2,4-dimethylcyclopenta-1,4-dien-1-yl)ethenyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine (PubChem CID 143595232) has the molecular formula C25H35N5 and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-(4-cyclobutylpiperazin-1-yl)-7-[1-(2,4-dimethylcyclopenta-1,4-dien-1-yl)ethenyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine.
| Compound Name | 2-(4-cyclobutylpiperazin-1-yl)-7-[1-(2,4-dimethylcyclopenta-1,4-dien-1-yl)ethenyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 143595232 |
| Molecular Formula | C25H35N5 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 2-(4-cyclobutylpiperazin-1-yl)-7-[1-(2,4-dimethylcyclopenta-1,4-dien-1-yl)ethenyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
| SMILES | C=C(C1=C(C)CC(C)=C1)N1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1 |
| InChI | InChI=1S/C25H35N5/c1-18-15-19(2)23(16-18)20(3)28-9-7-21-17-26-25(27-24(21)8-10-28)30-13-11-29(12-14-30)22-5-4-6-22/h16-17,22H,3-15H2,1-2H3 |
| InChIKey | DTIYMALVPXLLEP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |