C21H33N5 — CID 143595355
2-(4-cyclobutylpiperazin-1-yl)-7-[(Z)-pent-3-enyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine (PubChem CID 143595355) has the molecular formula C21H33N5 and a molecular weight of 355.53 g/mol. Its IUPAC name is 2-(4-cyclobutylpiperazin-1-yl)-7-[(Z)-pent-3-enyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine.
| Compound Name | 2-(4-cyclobutylpiperazin-1-yl)-7-[(Z)-pent-3-enyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 143595355 |
| Molecular Formula | C21H33N5 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 2-(4-cyclobutylpiperazin-1-yl)-7-[(Z)-pent-3-enyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
| SMILES | C/C=C\CCN1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1 |
| InChI | InChI=1S/C21H33N5/c1-2-3-4-10-24-11-8-18-17-22-21(23-20(18)9-12-24)26-15-13-25(14-16-26)19-6-5-7-19/h2-3,17,19H,4-16H2,1H3/b3-2- |
| InChIKey | AFDFKKXHXOPFEJ-IHWYPQMZSA-N |
| XLogP | 2.52 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|