C28H45N5 — CID 143595631
2-(4-cyclobutylpiperazin-1-yl)-7-ethenyl-6,8,9,10-tetrahydro-5H-pyrimido[5,4-d]azocine;(3Z)-hexa-1,3-diene;prop-1-ene (PubChem CID 143595631) has the molecular formula C28H45N5 and a molecular weight of 451.70 g/mol. Its IUPAC name is 2-(4-cyclobutylpiperazin-1-yl)-7-ethenyl-6,8,9,10-tetrahydro-5H-pyrimido[5,4-d]azocine;(3Z)-hexa-1,3-diene;prop-1-ene.
| Compound Name | 2-(4-cyclobutylpiperazin-1-yl)-7-ethenyl-6,8,9,10-tetrahydro-5H-pyrimido[5,4-d]azocine;(3Z)-hexa-1,3-diene;prop-1-ene |
|---|---|
| PubChem CID | 143595631 |
| Molecular Formula | C28H45N5 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.37 |
| IUPAC Name | 2-(4-cyclobutylpiperazin-1-yl)-7-ethenyl-6,8,9,10-tetrahydro-5H-pyrimido[5,4-d]azocine;(3Z)-hexa-1,3-diene;prop-1-ene |
| SMILES | C=C/C=C\CC.C=CC.C=CN1CCCc2nc(N3CCN(C4CCC4)CC3)ncc2CC1 |
| InChI | InChI=1S/C19H29N5.C6H10.C3H6/c1-2-22-9-4-7-18-16(8-10-22)15-20-19(21-18)24-13-11-23(12-14-24)17-5-3-6-17;1-3-5-6-4-2;1-3-2/h2,15,17H,1,3-14H2;3,5-6H,1,4H2,2H3;3H,1H2,2H3/b;6-5-; |
| InChIKey | ZYHBJLRDFKTZTO-XRPAZMCKSA-N |
| XLogP | 5.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|