C21H29NO2 — CID 143595389
(3E,5Z,7E)-N-methyl-8-(7-methylcyclohepta-1,4,6-trien-1-yl)oxy-N-propylnona-3,5,7-trienamide (PubChem CID 143595389) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (3E,5Z,7E)-N-methyl-8-(7-methylcyclohepta-1,4,6-trien-1-yl)oxy-N-propylnona-3,5,7-trienamide.
| Compound Name | (3E,5Z,7E)-N-methyl-8-(7-methylcyclohepta-1,4,6-trien-1-yl)oxy-N-propylnona-3,5,7-trienamide |
|---|---|
| PubChem CID | 143595389 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (3E,5Z,7E)-N-methyl-8-(7-methylcyclohepta-1,4,6-trien-1-yl)oxy-N-propylnona-3,5,7-trienamide |
| SMILES | CCCN(C)C(=O)C/C=C/C=C\C=C(/C)OC1=CCC=CC=C1C |
| InChI | InChI=1S/C21H29NO2/c1-5-17-22(4)21(23)16-12-7-6-10-14-19(3)24-20-15-11-8-9-13-18(20)2/h6-10,12-15H,5,11,16-17H2,1-4H3/b10-6-,12-7+,19-14+ |
| InChIKey | SQJQJMCDFPOWBZ-ITABVDGESA-N |
| XLogP | 5.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|