C19H35NO2 — CID 142986621
ethane;(4E)-5-methoxy-7-methyl-3-methylidene-N,N-dipropylocta-4,6-dienamide (PubChem CID 142986621) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is ethane;(4E)-5-methoxy-7-methyl-3-methylidene-N,N-dipropylocta-4,6-dienamide.
| Compound Name | ethane;(4E)-5-methoxy-7-methyl-3-methylidene-N,N-dipropylocta-4,6-dienamide |
|---|---|
| PubChem CID | 142986621 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | ethane;(4E)-5-methoxy-7-methyl-3-methylidene-N,N-dipropylocta-4,6-dienamide |
| SMILES | C=C(/C=C(\C=C(C)C)OC)CC(=O)N(CCC)CCC.CC |
| InChI | InChI=1S/C17H29NO2.C2H6/c1-7-9-18(10-8-2)17(19)13-15(5)12-16(20-6)11-14(3)4;1-2/h11-12H,5,7-10,13H2,1-4,6H3;1-2H3/b16-12+; |
| InChIKey | DLRTVTBQUIVCPW-CLNHMMGSSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|