C13H21NO2 — CID 153340109
N-[(4Z)-6-methoxy-2-methyl-3-methylidenehepta-4,6-dienyl]-N-methylacetamide (PubChem CID 153340109) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(4Z)-6-methoxy-2-methyl-3-methylidenehepta-4,6-dienyl]-N-methylacetamide.
| Compound Name | N-[(4Z)-6-methoxy-2-methyl-3-methylidenehepta-4,6-dienyl]-N-methylacetamide |
|---|---|
| PubChem CID | 153340109 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-[(4Z)-6-methoxy-2-methyl-3-methylidenehepta-4,6-dienyl]-N-methylacetamide |
| SMILES | C=C(/C=C\C(=C)C(C)CN(C)C(C)=O)OC |
| InChI | InChI=1S/C13H21NO2/c1-10(7-8-12(3)16-6)11(2)9-14(5)13(4)15/h7-8,11H,1,3,9H2,2,4-6H3/b8-7- |
| InChIKey | AOKRHHOSSIJGGE-FPLPWBNLSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|