C24H41NO2 — CID 143085945
ethane;N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[(2R,5Z,7E)-7-methoxydeca-5,7-dien-2-yl]acetamide (PubChem CID 143085945) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is ethane;N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[(2R,5Z,7E)-7-methoxydeca-5,7-dien-2-yl]acetamide.
| Compound Name | ethane;N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[(2R,5Z,7E)-7-methoxydeca-5,7-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 143085945 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | ethane;N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[(2R,5Z,7E)-7-methoxydeca-5,7-dien-2-yl]acetamide |
| SMILES | C=C/C=C\C(=C/C)[C@@H](C)N(C(C)=O)[C@H](C)CC/C=C\C(=C/CC)OC.CC |
| InChI | InChI=1S/C22H35NO2.C2H6/c1-8-11-16-21(10-3)19(5)23(20(6)24)18(4)15-12-13-17-22(25-7)14-9-2;1-2/h8,10-11,13-14,16-19H,1,9,12,15H2,2-7H3;1-2H3/b16-11-,17-13-,21-10+,22-14+;/t18-,19-;/m1./s1 |
| InChIKey | ZVXPUYSWAHQDCB-XFHFYTMOSA-N |
| XLogP | 6.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|