C8H13F3N2O — CID 143596283
amino-[[(5E)-7,7,7-trifluorohepta-1,5-dien-3-yl]amino]methanol (PubChem CID 143596283) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is amino-[[(5E)-7,7,7-trifluorohepta-1,5-dien-3-yl]amino]methanol.
| Compound Name | amino-[[(5E)-7,7,7-trifluorohepta-1,5-dien-3-yl]amino]methanol |
|---|---|
| PubChem CID | 143596283 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | amino-[[(5E)-7,7,7-trifluorohepta-1,5-dien-3-yl]amino]methanol |
| SMILES | C=CC(C/C=C/C(F)(F)F)NC(N)O |
| InChI | InChI=1S/C8H13F3N2O/c1-2-6(13-7(12)14)4-3-5-8(9,10)11/h2-3,5-7,13-14H,1,4,12H2/b5-3+ |
| InChIKey | AEJCZRQCVAYKPV-HWKANZROSA-N |
| XLogP | 0.87 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|