C6H12N2O — CID 163424451
(3E)-1,4-diaminohexa-3,5-dien-1-ol (PubChem CID 163424451) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is (3E)-1,4-diaminohexa-3,5-dien-1-ol.
| Compound Name | (3E)-1,4-diaminohexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 163424451 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (3E)-1,4-diaminohexa-3,5-dien-1-ol |
| SMILES | C=C/C(N)=C\CC(N)O |
| InChI | InChI=1S/C6H12N2O/c1-2-5(7)3-4-6(8)9/h2-3,6,9H,1,4,7-8H2/b5-3+ |
| InChIKey | ALGMKGHMKVNCPQ-HWKANZROSA-N |
| XLogP | -0.32 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|