C9H13BrN2S — CID 143598435
3-bromo-N,5-dimethylaniline;methanethioamide (PubChem CID 143598435) has the molecular formula C9H13BrN2S and a molecular weight of 261.19 g/mol. Its IUPAC name is 3-bromo-N,5-dimethylaniline;methanethioamide.
| Compound Name | 3-bromo-N,5-dimethylaniline;methanethioamide |
|---|---|
| PubChem CID | 143598435 |
| Molecular Formula | C9H13BrN2S |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-bromo-N,5-dimethylaniline;methanethioamide |
| SMILES | CNc1cc(C)cc(Br)c1.NC=S |
| InChI | InChI=1S/C8H10BrN.CH3NS/c1-6-3-7(9)5-8(4-6)10-2;2-1-3/h3-5,10H,1-2H3;1H,(H2,2,3) |
| InChIKey | SYOQBDDASXXRPE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|