About 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine
4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 143598561) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine.
Analyze 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine (CID 143598561) is 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine is C=CSC1=C(C)CN(C)CC1.
What is the InChIKey of 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine?
The InChIKey is KJXMMNGTIKGFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-4-11-9-5-6-10(3)7-8(9)2/h4H,1,5-7H2,2-3H3.
What are the key properties of 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine?
4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine has a molecular weight of 169.29 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylsulfanyl-1,5-dimethyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 143598561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).