C11H17N — CID 143601060
(6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methanimine (PubChem CID 143601060) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methanimine.
| Compound Name | (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methanimine |
|---|---|
| PubChem CID | 143601060 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methanimine |
| SMILES | [H]/N=C/C1CC(C)=C(C)CC1C=C |
| InChI | InChI=1S/C11H17N/c1-4-10-5-8(2)9(3)6-11(10)7-12/h4,7,10-12H,1,5-6H2,2-3H3/b12-7+ |
| InChIKey | BSXQGKFBSRCDKB-KPKJPENVSA-N |
| XLogP | 3.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|