C21H22FN5O3S — CID 143601198
ethyl (2Z)-2-(1-fluoroethenyl)-4-[[2-methyl-1-oxo-1-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)propan-2-yl]amino]penta-2,4-dienoate (PubChem CID 143601198) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-fluoroethenyl)-4-[[2-methyl-1-oxo-1-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)propan-2-yl]amino]penta-2,4-dienoate.
| Compound Name | ethyl (2Z)-2-(1-fluoroethenyl)-4-[[2-methyl-1-oxo-1-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)propan-2-yl]amino]penta-2,4-dienoate |
|---|---|
| PubChem CID | 143601198 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | ethyl (2Z)-2-(1-fluoroethenyl)-4-[[2-methyl-1-oxo-1-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)propan-2-yl]amino]penta-2,4-dienoate |
| SMILES | C=C(/C=C(\C(=C)F)C(=O)OCC)NC(C)(C)C(=O)Nc1nc2ccc3[nH]ncc3c2s1 |
| InChI | InChI=1S/C21H22FN5O3S/c1-6-30-18(28)13(12(3)22)9-11(2)26-21(4,5)19(29)25-20-24-16-8-7-15-14(10-23-27-15)17(16)31-20/h7-10,26H,2-3,6H2,1,4-5H3,(H,23,27)(H,24,25,29)/b13-9+ |
| InChIKey | AVNKNSBTSJRKTB-UKTHLTGXSA-N |
| XLogP | 3.97 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|