C28H40N2 — CID 143601433
2-N,11-N-bis(3,5-dimethylphenyl)dodeca-1,11-diene-2,11-diamine (PubChem CID 143601433) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-N,11-N-bis(3,5-dimethylphenyl)dodeca-1,11-diene-2,11-diamine.
| Compound Name | 2-N,11-N-bis(3,5-dimethylphenyl)dodeca-1,11-diene-2,11-diamine |
|---|---|
| PubChem CID | 143601433 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 2-N,11-N-bis(3,5-dimethylphenyl)dodeca-1,11-diene-2,11-diamine |
| SMILES | C=C(CCCCCCCCC(=C)Nc1cc(C)cc(C)c1)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C28H40N2/c1-21-15-22(2)18-27(17-21)29-25(5)13-11-9-7-8-10-12-14-26(6)30-28-19-23(3)16-24(4)20-28/h15-20,29-30H,5-14H2,1-4H3 |
| InChIKey | LDZHFUJMGUEKEB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|