C18H29NO2 — CID 159298128
N-(3,5-dimethylphenyl)acetamide;hept-6-en-2-one;methane (PubChem CID 159298128) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)acetamide;hept-6-en-2-one;methane.
| Compound Name | N-(3,5-dimethylphenyl)acetamide;hept-6-en-2-one;methane |
|---|---|
| PubChem CID | 159298128 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-(3,5-dimethylphenyl)acetamide;hept-6-en-2-one;methane |
| SMILES | C.C=CCCCC(C)=O.CC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C10H13NO.C7H12O.CH4/c1-7-4-8(2)6-10(5-7)11-9(3)12;1-3-4-5-6-7(2)8;/h4-6H,1-3H3,(H,11,12);3H,1,4-6H2,2H3;1H4 |
| InChIKey | LAZHVKIRZORNBF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|