About heptan-2-one;pent-1-ene
heptan-2-one;pent-1-ene (PubChem CID 21192006) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is heptan-2-one;pent-1-ene.
Molecular Properties
| Compound Name | heptan-2-one;pent-1-ene |
| PubChem CID | 21192006 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | heptan-2-one;pent-1-ene |
| SMILES | C=CCCC.CCCCCC(C)=O |
| InChI | InChI=1S/C7H14O.C5H10/c1-3-4-5-6-7(2)8;1-3-5-4-2/h3-6H2,1-2H3;3H,1,4-5H2,2H3 |
| InChIKey | YIXQGARGMQSTMY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-one;pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-one;pent-1-ene?
The IUPAC name of heptan-2-one;pent-1-ene (CID 21192006) is heptan-2-one;pent-1-ene.
What is the SMILES notation for heptan-2-one;pent-1-ene?
The canonical SMILES for heptan-2-one;pent-1-ene is C=CCCC.CCCCCC(C)=O.
What is the InChIKey of heptan-2-one;pent-1-ene?
The InChIKey is YIXQGARGMQSTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C5H10/c1-3-4-5-6-7(2)8;1-3-5-4-2/h3-6H2,1-2H3;3H,1,4-5H2,2H3.
What are the key properties of heptan-2-one;pent-1-ene?
heptan-2-one;pent-1-ene has a molecular weight of 184.32 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-one;pent-1-ene is sourced from PubChem (CID 21192006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).