About heptan-2-one;pent-4-enoic acid
heptan-2-one;pent-4-enoic acid (PubChem CID 175716466) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is heptan-2-one;pent-4-enoic acid.
Molecular Properties
| Compound Name | heptan-2-one;pent-4-enoic acid |
| PubChem CID | 175716466 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | heptan-2-one;pent-4-enoic acid |
| SMILES | C=CCCC(=O)O.CCCCCC(C)=O |
| InChI | InChI=1S/C7H14O.C5H8O2/c1-3-4-5-6-7(2)8;1-2-3-4-5(6)7/h3-6H2,1-2H3;2H,1,3-4H2,(H,6,7) |
| InChIKey | NMENCMABEMYIGY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-one;pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-one;pent-4-enoic acid?
The IUPAC name of heptan-2-one;pent-4-enoic acid (CID 175716466) is heptan-2-one;pent-4-enoic acid.
What is the SMILES notation for heptan-2-one;pent-4-enoic acid?
The canonical SMILES for heptan-2-one;pent-4-enoic acid is C=CCCC(=O)O.CCCCCC(C)=O.
What is the InChIKey of heptan-2-one;pent-4-enoic acid?
The InChIKey is NMENCMABEMYIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C5H8O2/c1-3-4-5-6-7(2)8;1-2-3-4-5(6)7/h3-6H2,1-2H3;2H,1,3-4H2,(H,6,7).
What are the key properties of heptan-2-one;pent-4-enoic acid?
heptan-2-one;pent-4-enoic acid has a molecular weight of 214.30 g/mol, XLogP of 3.19, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-one;pent-4-enoic acid is sourced from PubChem (CID 175716466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).