C19H29N — CID 146304151
N-(7,7-dimethyloct-1-en-2-yl)-4-prop-1-en-2-ylaniline (PubChem CID 146304151) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is N-(7,7-dimethyloct-1-en-2-yl)-4-prop-1-en-2-ylaniline.
| Compound Name | N-(7,7-dimethyloct-1-en-2-yl)-4-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 146304151 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-(7,7-dimethyloct-1-en-2-yl)-4-prop-1-en-2-ylaniline |
| SMILES | C=C(CCCCC(C)(C)C)Nc1ccc(C(=C)C)cc1 |
| InChI | InChI=1S/C19H29N/c1-15(2)17-10-12-18(13-11-17)20-16(3)9-7-8-14-19(4,5)6/h10-13,20H,1,3,7-9,14H2,2,4-6H3 |
| InChIKey | WZVAHZQNGPJDIO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|