C18H29N — CID 143117766
6,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]heptan-2-amine (PubChem CID 143117766) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 6,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]heptan-2-amine.
| Compound Name | 6,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]heptan-2-amine |
|---|---|
| PubChem CID | 143117766 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 6,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]heptan-2-amine |
| SMILES | C=C(NC(C)CCCC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H29N/c1-14-9-11-17(12-10-14)16(3)19-15(2)8-7-13-18(4,5)6/h9-12,15,19H,3,7-8,13H2,1-2,4-6H3 |
| InChIKey | PIVTVZIOXUNIQR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |