C16H28N2 — CID 89114404
6,6-dimethyl-N-[3-(prop-2-enylideneamino)buta-1,3-dien-2-yl]heptan-2-amine (PubChem CID 89114404) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 6,6-dimethyl-N-[3-(prop-2-enylideneamino)buta-1,3-dien-2-yl]heptan-2-amine.
| Compound Name | 6,6-dimethyl-N-[3-(prop-2-enylideneamino)buta-1,3-dien-2-yl]heptan-2-amine |
|---|---|
| PubChem CID | 89114404 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 6,6-dimethyl-N-[3-(prop-2-enylideneamino)buta-1,3-dien-2-yl]heptan-2-amine |
| SMILES | C=C/C=N/C(=C)C(=C)NC(C)CCCC(C)(C)C |
| InChI | InChI=1S/C16H28N2/c1-8-12-17-14(3)15(4)18-13(2)10-9-11-16(5,6)7/h8,12-13,18H,1,3-4,9-11H2,2,5-7H3/b17-12+ |
| InChIKey | KAOQWHPANWHMOA-SFQUDFHCSA-N |
| XLogP | 4.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|