C15H32N2 — CID 172961603
(2R)-N-[(E)-hexan-3-ylideneamino]-6,6-dimethylheptan-2-amine (PubChem CID 172961603) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is (2R)-N-[(E)-hexan-3-ylideneamino]-6,6-dimethylheptan-2-amine.
| Compound Name | (2R)-N-[(E)-hexan-3-ylideneamino]-6,6-dimethylheptan-2-amine |
|---|---|
| PubChem CID | 172961603 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | (2R)-N-[(E)-hexan-3-ylideneamino]-6,6-dimethylheptan-2-amine |
| SMILES | CCC/C(CC)=N/N[C@H](C)CCCC(C)(C)C |
| InChI | InChI=1S/C15H32N2/c1-7-10-14(8-2)17-16-13(3)11-9-12-15(4,5)6/h13,16H,7-12H2,1-6H3/b17-14+/t13-/m1/s1 |
| InChIKey | CUMLCBMOZMFITK-UDIPDBSGSA-N |
| XLogP | 4.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|