About chloromethane;ethane;N-ethynyl-2-methylaniline
chloromethane;ethane;N-ethynyl-2-methylaniline (PubChem CID 143604778) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is chloromethane;ethane;N-ethynyl-2-methylaniline.
Molecular Properties
| Compound Name | chloromethane;ethane;N-ethynyl-2-methylaniline |
| PubChem CID | 143604778 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | chloromethane;ethane;N-ethynyl-2-methylaniline |
| SMILES | C#CNc1ccccc1C.CC.CCl |
| InChI | InChI=1S/C9H9N.C2H6.CH3Cl/c1-3-10-9-7-5-4-6-8(9)2;2*1-2/h1,4-7,10H,2H3;1-2H3;1H3 |
| InChIKey | WIENKQNEJMNXHC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;ethane;N-ethynyl-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;ethane;N-ethynyl-2-methylaniline?
The IUPAC name of chloromethane;ethane;N-ethynyl-2-methylaniline (CID 143604778) is chloromethane;ethane;N-ethynyl-2-methylaniline.
What is the SMILES notation for chloromethane;ethane;N-ethynyl-2-methylaniline?
The canonical SMILES for chloromethane;ethane;N-ethynyl-2-methylaniline is C#CNc1ccccc1C.CC.CCl.
What is the InChIKey of chloromethane;ethane;N-ethynyl-2-methylaniline?
The InChIKey is WIENKQNEJMNXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H6.CH3Cl/c1-3-10-9-7-5-4-6-8(9)2;2*1-2/h1,4-7,10H,2H3;1-2H3;1H3.
What are the key properties of chloromethane;ethane;N-ethynyl-2-methylaniline?
chloromethane;ethane;N-ethynyl-2-methylaniline has a molecular weight of 211.74 g/mol, XLogP of 3.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;ethane;N-ethynyl-2-methylaniline is sourced from PubChem (CID 143604778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).