C29H35N2O9PS — CID 143606708
acetylene;N-[5-(diethoxyphosphorylmethyl)-2-pyridinyl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide (PubChem CID 143606708) has the molecular formula C29H35N2O9PS and a molecular weight of 618.65 g/mol. Its IUPAC name is acetylene;N-[5-(diethoxyphosphorylmethyl)-2-pyridinyl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide.
| Compound Name | acetylene;N-[5-(diethoxyphosphorylmethyl)-2-pyridinyl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide |
|---|---|
| PubChem CID | 143606708 |
| Molecular Formula | C29H35N2O9PS |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | acetylene;N-[5-(diethoxyphosphorylmethyl)-2-pyridinyl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide |
| SMILES | C#C.CCOP(=O)(Cc1ccc(NC(=O)c2cc(OCCOC)cc(Oc3ccc(S(C)(=O)=O)cc3)c2)nc1)OCC |
| InChI | InChI=1S/C27H33N2O9PS.C2H2/c1-5-36-39(31,37-6-2)19-20-7-12-26(28-18-20)29-27(30)21-15-23(35-14-13-34-3)17-24(16-21)38-22-8-10-25(11-9-22)40(4,32)33;1-2/h7-12,15-18H,5-6,13-14,19H2,1-4H3,(H,28,29,30);1-2H |
| InChIKey | JDKISVVRCLXYLV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|