C26H34N3O9PS — CID 87420234
N-[1-(diethoxyphosphorylmethyl)-5-methylpyrazol-3-yl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide (PubChem CID 87420234) has the molecular formula C26H34N3O9PS and a molecular weight of 595.61 g/mol. Its IUPAC name is N-[1-(diethoxyphosphorylmethyl)-5-methylpyrazol-3-yl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide.
| Compound Name | N-[1-(diethoxyphosphorylmethyl)-5-methylpyrazol-3-yl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide |
|---|---|
| PubChem CID | 87420234 |
| Molecular Formula | C26H34N3O9PS |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | N-[1-(diethoxyphosphorylmethyl)-5-methylpyrazol-3-yl]-3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)benzamide |
| SMILES | CCOP(=O)(Cn1nc(NC(=O)c2cc(OCCOC)cc(Oc3ccc(S(C)(=O)=O)cc3)c2)cc1C)OCC |
| InChI | InChI=1S/C26H34N3O9PS/c1-6-36-39(31,37-7-2)18-29-19(3)14-25(28-29)27-26(30)20-15-22(35-13-12-34-4)17-23(16-20)38-21-8-10-24(11-9-21)40(5,32)33/h8-11,14-17H,6-7,12-13,18H2,1-5H3,(H,27,28,30) |
| InChIKey | AZIXXDCOFMCRDP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|