C21H22N2O6S2 — CID 67489956
N-[3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)phenyl]-5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 67489956) has the molecular formula C21H22N2O6S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)phenyl]-5-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)phenyl]-5-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 67489956 |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-[3-(2-methoxyethoxy)-5-(4-methylsulfonylphenoxy)phenyl]-5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | COCCOc1cc(NC(=O)c2ncc(C)s2)cc(Oc2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C21H22N2O6S2/c1-14-13-22-21(30-14)20(24)23-15-10-17(28-9-8-27-2)12-18(11-15)29-16-4-6-19(7-5-16)31(3,25)26/h4-7,10-13H,8-9H2,1-3H3,(H,23,24) |
| InChIKey | LUEXFHXCFOJWNQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|