C40H35N3O7S — CID 59627778
methyl (2S)-2-[3-(4-methylsulfonylphenoxy)-5-[(1-tritylimidazole-4-carbonyl)amino]phenoxy]propanoate (PubChem CID 59627778) has the molecular formula C40H35N3O7S and a molecular weight of 701.80 g/mol. Its IUPAC name is methyl (2S)-2-[3-(4-methylsulfonylphenoxy)-5-[(1-tritylimidazole-4-carbonyl)amino]phenoxy]propanoate.
| Compound Name | methyl (2S)-2-[3-(4-methylsulfonylphenoxy)-5-[(1-tritylimidazole-4-carbonyl)amino]phenoxy]propanoate |
|---|---|
| PubChem CID | 59627778 |
| Molecular Formula | C40H35N3O7S |
| Molecular Weight | 701.80 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | methyl (2S)-2-[3-(4-methylsulfonylphenoxy)-5-[(1-tritylimidazole-4-carbonyl)amino]phenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1cc(NC(=O)c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)cc(Oc2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C40H35N3O7S/c1-28(39(45)48-2)49-34-23-32(24-35(25-34)50-33-19-21-36(22-20-33)51(3,46)47)42-38(44)37-26-43(27-41-37)40(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-28H,1-3H3,(H,42,44)/t28-/m0/s1 |
| InChIKey | SNLNXHDTSCAVLQ-NDEPHWFRSA-N |
| XLogP | 7.11 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.80 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|