C23H31ClN2O3 — CID 143606746
(5S)-5-[(4-chlorophenyl)methyl]-3-[(2S)-1-cyclohexyl-4-methyl-3-oxohexan-2-yl]imidazolidine-2,4-dione (PubChem CID 143606746) has the molecular formula C23H31ClN2O3 and a molecular weight of 418.97 g/mol. Its IUPAC name is (5S)-5-[(4-chlorophenyl)methyl]-3-[(2S)-1-cyclohexyl-4-methyl-3-oxohexan-2-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(4-chlorophenyl)methyl]-3-[(2S)-1-cyclohexyl-4-methyl-3-oxohexan-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143606746 |
| Molecular Formula | C23H31ClN2O3 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (5S)-5-[(4-chlorophenyl)methyl]-3-[(2S)-1-cyclohexyl-4-methyl-3-oxohexan-2-yl]imidazolidine-2,4-dione |
| SMILES | CCC(C)C(=O)[C@H](CC1CCCCC1)N1C(=O)N[C@@H](Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H31ClN2O3/c1-3-15(2)21(27)20(14-16-7-5-4-6-8-16)26-22(28)19(25-23(26)29)13-17-9-11-18(24)12-10-17/h9-12,15-16,19-20H,3-8,13-14H2,1-2H3,(H,25,29)/t15?,19-,20-/m0/s1 |
| InChIKey | XXZILVZHHANZFN-FIRGRZAASA-N |
| XLogP | 4.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|