C21H29NO2 — CID 156788005
(3R)-4-benzyl-3-[(2R)-3-cyclohexyl-2-methylpropanoyl]pyrrolidin-2-one (PubChem CID 156788005) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (3R)-4-benzyl-3-[(2R)-3-cyclohexyl-2-methylpropanoyl]pyrrolidin-2-one.
| Compound Name | (3R)-4-benzyl-3-[(2R)-3-cyclohexyl-2-methylpropanoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 156788005 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (3R)-4-benzyl-3-[(2R)-3-cyclohexyl-2-methylpropanoyl]pyrrolidin-2-one |
| SMILES | C[C@H](CC1CCCCC1)C(=O)[C@@H]1C(=O)NCC1Cc1ccccc1 |
| InChI | InChI=1S/C21H29NO2/c1-15(12-16-8-4-2-5-9-16)20(23)19-18(14-22-21(19)24)13-17-10-6-3-7-11-17/h3,6-7,10-11,15-16,18-19H,2,4-5,8-9,12-14H2,1H3,(H,22,24)/t15-,18?,19-/m1/s1 |
| InChIKey | IDMHBHNSZNMFPN-QYHYLKRQSA-N |
| XLogP | 3.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|