C21H27NO2 — CID 141260225
4-benzyl-3-[2-(cyclohexylmethyl)prop-2-enoyl]pyrrolidin-2-one (PubChem CID 141260225) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 4-benzyl-3-[2-(cyclohexylmethyl)prop-2-enoyl]pyrrolidin-2-one.
| Compound Name | 4-benzyl-3-[2-(cyclohexylmethyl)prop-2-enoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141260225 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4-benzyl-3-[2-(cyclohexylmethyl)prop-2-enoyl]pyrrolidin-2-one |
| SMILES | C=C(CC1CCCCC1)C(=O)C1C(=O)NCC1Cc1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-15(12-16-8-4-2-5-9-16)20(23)19-18(14-22-21(19)24)13-17-10-6-3-7-11-17/h3,6-7,10-11,16,18-19H,1-2,4-5,8-9,12-14H2,(H,22,24) |
| InChIKey | PFDBJXPVROBAQM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|