C13H16N2O2 — CID 132539583
2-[(3S,4S)-4-benzyl-2-oxopyrrolidin-3-yl]acetamide (PubChem CID 132539583) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[(3S,4S)-4-benzyl-2-oxopyrrolidin-3-yl]acetamide.
| Compound Name | 2-[(3S,4S)-4-benzyl-2-oxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 132539583 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[(3S,4S)-4-benzyl-2-oxopyrrolidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1C(=O)NC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c14-12(16)7-11-10(8-15-13(11)17)6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H2,14,16)(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | TXVPUSPIFFAFAQ-MNOVXSKESA-N |
| XLogP | 0.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |