C16H18F3NO2 — CID 156788011
(3R)-4-benzyl-3-[(2R)-4,4,4-trifluoro-2-methylbutanoyl]pyrrolidin-2-one (PubChem CID 156788011) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is (3R)-4-benzyl-3-[(2R)-4,4,4-trifluoro-2-methylbutanoyl]pyrrolidin-2-one.
| Compound Name | (3R)-4-benzyl-3-[(2R)-4,4,4-trifluoro-2-methylbutanoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 156788011 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3R)-4-benzyl-3-[(2R)-4,4,4-trifluoro-2-methylbutanoyl]pyrrolidin-2-one |
| SMILES | C[C@H](CC(F)(F)F)C(=O)[C@@H]1C(=O)NCC1Cc1ccccc1 |
| InChI | InChI=1S/C16H18F3NO2/c1-10(8-16(17,18)19)14(21)13-12(9-20-15(13)22)7-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3,(H,20,22)/t10-,12?,13-/m1/s1 |
| InChIKey | VIKDBLCGQHFSOX-SJMSNRFBSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|