C16H22ClNO5 — CID 143609596
(1R,4R,5S)-4-(2-chloroethyl)-1-[hydroxy-[(2R,6S)-7-oxabicyclo[4.1.0]heptan-2-yl]methyl]-4,5-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 143609596) has the molecular formula C16H22ClNO5 and a molecular weight of 343.81 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[hydroxy-[(2R,6S)-7-oxabicyclo[4.1.0]heptan-2-yl]methyl]-4,5-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[hydroxy-[(2R,6S)-7-oxabicyclo[4.1.0]heptan-2-yl]methyl]-4,5-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 143609596 |
| Molecular Formula | C16H22ClNO5 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[hydroxy-[(2R,6S)-7-oxabicyclo[4.1.0]heptan-2-yl]methyl]-4,5-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@]12OC(=O)[C@]1(C(O)[C@H]1CCC[C@@H]3OC13)NC(=O)[C@]2(C)CCCl |
| InChI | InChI=1S/C16H22ClNO5/c1-14(6-7-17)12(20)18-16(13(21)23-15(14,16)2)11(19)8-4-3-5-9-10(8)22-9/h8-11,19H,3-7H2,1-2H3,(H,18,20)/t8-,9-,10?,11?,14-,15-,16-/m0/s1 |
| InChIKey | AHJRSVIQYDHZHY-JLSJEMBESA-N |
| XLogP | 0.73 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|