C15H13Cl2F3N2O2S — CID 143610499
4-chloro-N-(5-chloro-2-formyl-3-pyridinyl)-3-(trifluoromethyl)benzenesulfinamide;ethane (PubChem CID 143610499) has the molecular formula C15H13Cl2F3N2O2S and a molecular weight of 413.25 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-formyl-3-pyridinyl)-3-(trifluoromethyl)benzenesulfinamide;ethane.
| Compound Name | 4-chloro-N-(5-chloro-2-formyl-3-pyridinyl)-3-(trifluoromethyl)benzenesulfinamide;ethane |
|---|---|
| PubChem CID | 143610499 |
| Molecular Formula | C15H13Cl2F3N2O2S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-formyl-3-pyridinyl)-3-(trifluoromethyl)benzenesulfinamide;ethane |
| SMILES | CC.O=Cc1ncc(Cl)cc1NS(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7Cl2F3N2O2S.C2H6/c14-7-3-11(12(6-21)19-5-7)20-23(22)8-1-2-10(15)9(4-8)13(16,17)18;1-2/h1-6,20H;1-2H3 |
| InChIKey | NFCNXEBNWNUPQO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|