C8H9FO2 — CID 143610538
(2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dienal (PubChem CID 143610538) has the molecular formula C8H9FO2 and a molecular weight of 156.16 g/mol. Its IUPAC name is (2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dienal.
| Compound Name | (2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dienal |
|---|---|
| PubChem CID | 143610538 |
| Molecular Formula | C8H9FO2 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dienal |
| SMILES | C=C/C(OC)=C(/C=O)C(=C)F |
| InChI | InChI=1S/C8H9FO2/c1-4-8(11-3)7(5-10)6(2)9/h4-5H,1-2H2,3H3/b8-7+ |
| InChIKey | WZDKZJZTUVYLAC-BQYQJAHWSA-N |
| XLogP | 1.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|