C13H24N2 — CID 143611153
ethane;1-ethenyl-N,4-dimethylpyridin-2-imine (PubChem CID 143611153) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;1-ethenyl-N,4-dimethylpyridin-2-imine.
| Compound Name | ethane;1-ethenyl-N,4-dimethylpyridin-2-imine |
|---|---|
| PubChem CID | 143611153 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;1-ethenyl-N,4-dimethylpyridin-2-imine |
| SMILES | C=Cn1ccc(C)c/c1=N\C.CC.CC |
| InChI | InChI=1S/C9H12N2.2C2H6/c1-4-11-6-5-8(2)7-9(11)10-3;2*1-2/h4-7H,1H2,2-3H3;2*1-2H3/b10-9+;; |
| InChIKey | BCFSTFKMLOONQZ-TTWKNDKESA-N |
| XLogP | 3.48 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |