About 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate
2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate (PubChem CID 143612159) has the molecular formula C21H35NO2
and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate.
Molecular Properties
| Compound Name | 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate |
| PubChem CID | 143612159 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate |
| SMILES | CC(=O)OC(C)(C)C.CCCc1ccc(C2CC2)nc1C(C)CC |
| InChI | InChI=1S/C15H23N.C6H12O2/c1-4-6-13-9-10-14(12-7-8-12)16-15(13)11(3)5-2;1-5(7)8-6(2,3)4/h9-12H,4-8H2,1-3H3;1-4H3 |
| InChIKey | WFBNWYGTZHNJLY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate?
The IUPAC name of 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate (CID 143612159) is 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate.
What is the SMILES notation for 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate?
The canonical SMILES for 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate is CC(=O)OC(C)(C)C.CCCc1ccc(C2CC2)nc1C(C)CC.
What is the InChIKey of 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate?
The InChIKey is WFBNWYGTZHNJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N.C6H12O2/c1-4-6-13-9-10-14(12-7-8-12)16-15(13)11(3)5-2;1-5(7)8-6(2,3)4/h9-12H,4-8H2,1-3H3;1-4H3.
What are the key properties of 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate?
2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate has a molecular weight of 333.52 g/mol, XLogP of 5.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-6-cyclopropyl-3-propylpyridine;tert-butyl acetate is sourced from PubChem (CID 143612159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).