C16H23F — CID 143612352
1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene (PubChem CID 143612352) has the molecular formula C16H23F and a molecular weight of 234.36 g/mol. Its IUPAC name is 1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene.
| Compound Name | 1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 143612352 |
| Molecular Formula | C16H23F |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene |
| SMILES | CC1=CCC(C)CC1.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H9F.C8H14/c1-6-3-4-7(2)8(9)5-6;1-7-3-5-8(2)6-4-7/h3-5H,1-2H3;3,8H,4-6H2,1-2H3 |
| InChIKey | MRLRTLRNVZLSDL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|