C19H24FNOS — CID 143612842
3-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]-1-[1-(hydroxymethyl)cyclopentyl]but-3-ene-2-thione (PubChem CID 143612842) has the molecular formula C19H24FNOS and a molecular weight of 333.47 g/mol. Its IUPAC name is 3-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]-1-[1-(hydroxymethyl)cyclopentyl]but-3-ene-2-thione.
| Compound Name | 3-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]-1-[1-(hydroxymethyl)cyclopentyl]but-3-ene-2-thione |
|---|---|
| PubChem CID | 143612842 |
| Molecular Formula | C19H24FNOS |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]-1-[1-(hydroxymethyl)cyclopentyl]but-3-ene-2-thione |
| SMILES | C=C(NC1CCc2c(F)cccc21)C(=S)CC1(CO)CCCC1 |
| InChI | InChI=1S/C19H24FNOS/c1-13(18(23)11-19(12-22)9-2-3-10-19)21-17-8-7-14-15(17)5-4-6-16(14)20/h4-6,17,21-22H,1-3,7-12H2 |
| InChIKey | MHJVAJDVQOIVQF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|