C36H48N6O4S2 — CID 143613766
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[(2,2-dimethyl-3H-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 143613766) has the molecular formula C36H48N6O4S2 and a molecular weight of 692.95 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[(2,2-dimethyl-3H-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[(2,2-dimethyl-3H-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 143613766 |
| Molecular Formula | C36H48N6O4S2 |
| Molecular Weight | 692.95 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[(2,2-dimethyl-3H-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)N(C)CC1=CSC(C)(C)N1)C(=O)N[C@H](CC[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C36H48N6O4S2/c1-25(2)32(40-34(44)42(5)21-30-23-48-36(3,4)41-30)33(43)38-28(18-26-12-8-6-9-13-26)16-17-29(19-27-14-10-7-11-15-27)39-35(45)46-22-31-20-37-24-47-31/h6-15,20,23-25,28-29,32,41H,16-19,21-22H2,1-5H3,(H,38,43)(H,39,45)(H,40,44)/t28-,29-,32+/m1/s1 |
| InChIKey | KWVBVPGVJAQIOO-PUCLRWMGSA-N |
| XLogP | 6.07 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.95 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |