C21H22N2O3 — CID 143615484
(E)-3-hydroxy-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-(4-methylbenzenecarboximidoyl)prop-2-en-1-one (PubChem CID 143615484) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-3-hydroxy-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-(4-methylbenzenecarboximidoyl)prop-2-en-1-one.
| Compound Name | (E)-3-hydroxy-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-(4-methylbenzenecarboximidoyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 143615484 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-3-hydroxy-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-(4-methylbenzenecarboximidoyl)prop-2-en-1-one |
| SMILES | [H]/N=C(C(=C/O)\C(=O)N1CCC(O)(c2ccccc2)C1)/c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-15-7-9-16(10-8-15)19(22)18(13-24)20(25)23-12-11-21(26,14-23)17-5-3-2-4-6-17/h2-10,13,22,24,26H,11-12,14H2,1H3/b18-13+,22-19- |
| InChIKey | RCIMQACBQVEQNO-MCMLNHIXSA-N |
| XLogP | 2.92 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|