C28H52N2O3 — CID 143615624
1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]pyrrolidine;ethane;1-(methylamino)decan-1-ol (PubChem CID 143615624) has the molecular formula C28H52N2O3 and a molecular weight of 464.74 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]pyrrolidine;ethane;1-(methylamino)decan-1-ol.
| Compound Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]pyrrolidine;ethane;1-(methylamino)decan-1-ol |
|---|---|
| PubChem CID | 143615624 |
| Molecular Formula | C28H52N2O3 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.40 |
| IUPAC Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]pyrrolidine;ethane;1-(methylamino)decan-1-ol |
| SMILES | CC.CCCCCCCCCC(O)NC.c1cc2c(cc1CCCN1CCCC1)OCCO2 |
| InChI | InChI=1S/C15H21NO2.C11H25NO.C2H6/c1-2-8-16(7-1)9-3-4-13-5-6-14-15(12-13)18-11-10-17-14;1-3-4-5-6-7-8-9-10-11(13)12-2;1-2/h5-6,12H,1-4,7-11H2;11-13H,3-10H2,1-2H3;1-2H3 |
| InChIKey | UJCPSGZOUNYIGK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|