C19H28N2O3 — CID 91475489
2-[4-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]piperazin-1-yl]propanal (PubChem CID 91475489) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[4-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]piperazin-1-yl]propanal.
| Compound Name | 2-[4-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]piperazin-1-yl]propanal |
|---|---|
| PubChem CID | 91475489 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[4-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]piperazin-1-yl]propanal |
| SMILES | CC(C=O)N1CCN(CCCc2ccc3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C19H28N2O3/c1-16(15-22)21-10-8-20(9-11-21)7-2-4-17-5-6-18-19(14-17)24-13-3-12-23-18/h5-6,14-16H,2-4,7-13H2,1H3 |
| InChIKey | IBIIEYYHPUFPRC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|