C13H17ClO2 — CID 54449265
7-(4-chlorobutyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 54449265) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 7-(4-chlorobutyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(4-chlorobutyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 54449265 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 7-(4-chlorobutyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | ClCCCCc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H17ClO2/c14-7-2-1-4-11-5-6-12-13(10-11)16-9-3-8-15-12/h5-6,10H,1-4,7-9H2 |
| InChIKey | WTTSZALULOVRIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|