About 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid
2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid (PubChem CID 143616805) has the molecular formula C10H12FNO2
and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid |
| PubChem CID | 143616805 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid |
| SMILES | CC1(F)C=C(N)C=CC(CC(=O)O)=C1 |
| InChI | InChI=1S/C10H12FNO2/c1-10(11)5-7(4-9(13)14)2-3-8(12)6-10/h2-3,5-6H,4,12H2,1H3,(H,13,14) |
| InChIKey | XIZWOVLCIUXNHY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid?
The IUPAC name of 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid (CID 143616805) is 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid.
What is the SMILES notation for 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid?
The canonical SMILES for 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid is CC1(F)C=C(N)C=CC(CC(=O)O)=C1.
What is the InChIKey of 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid?
The InChIKey is XIZWOVLCIUXNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO2/c1-10(11)5-7(4-9(13)14)2-3-8(12)6-10/h2-3,5-6H,4,12H2,1H3,(H,13,14).
What are the key properties of 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid?
2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid has a molecular weight of 197.21 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)acetic acid is sourced from PubChem (CID 143616805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).