C17H14FN3O — CID 143617567
(E)-N-[(4-amino-3-ethynyl-5-fluorophenyl)methyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 143617567) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is (E)-N-[(4-amino-3-ethynyl-5-fluorophenyl)methyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(4-amino-3-ethynyl-5-fluorophenyl)methyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 143617567 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (E)-N-[(4-amino-3-ethynyl-5-fluorophenyl)methyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C/c2cccnc2)cc(F)c1N |
| InChI | InChI=1S/C17H14FN3O/c1-2-14-8-13(9-15(18)17(14)19)11-21-16(22)6-5-12-4-3-7-20-10-12/h1,3-10H,11,19H2,(H,21,22)/b6-5+ |
| InChIKey | QJNNFMGDBBOXLW-AATRIKPKSA-N |
| XLogP | 2.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|