C22H24FN3O3S — CID 90699608
2-tert-butyl-5-[3-[[3-ethynyl-5-fluoro-4-[methyl(sulfino)amino]phenyl]methylamino]-3-oxoprop-1-enyl]pyridine (PubChem CID 90699608) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-tert-butyl-5-[3-[[3-ethynyl-5-fluoro-4-[methyl(sulfino)amino]phenyl]methylamino]-3-oxoprop-1-enyl]pyridine.
| Compound Name | 2-tert-butyl-5-[3-[[3-ethynyl-5-fluoro-4-[methyl(sulfino)amino]phenyl]methylamino]-3-oxoprop-1-enyl]pyridine |
|---|---|
| PubChem CID | 90699608 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-tert-butyl-5-[3-[[3-ethynyl-5-fluoro-4-[methyl(sulfino)amino]phenyl]methylamino]-3-oxoprop-1-enyl]pyridine |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(C(C)(C)C)nc2)cc(F)c1N(C)S(=O)O |
| InChI | InChI=1S/C22H24FN3O3S/c1-6-17-11-16(12-18(23)21(17)26(5)30(28)29)14-25-20(27)10-8-15-7-9-19(24-13-15)22(2,3)4/h1,7-13H,14H2,2-5H3,(H,25,27)(H,28,29) |
| InChIKey | YLXNAMAMPSRZPT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|