C21H29N3O3 — CID 143618867
N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-1,6-naphthyridine-3-carboxamide (PubChem CID 143618867) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-1,6-naphthyridine-3-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 143618867 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-1,6-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)C1C(=O)NC2CCNCC2C1O |
| InChI | InChI=1S/C21H29N3O3/c25-19-16-12-22-11-10-17(16)24-21(27)18(19)20(26)23-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-9,13,16-19,22,25H,1-5,10-12H2,(H,23,26)(H,24,27) |
| InChIKey | AXZOOCWVIDYUPL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|