C17H17F2N3O — CID 175718166
3,5-difluoro-N-[4-[(3R)-piperidin-3-yl]phenyl]pyridine-2-carboxamide (PubChem CID 175718166) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is 3,5-difluoro-N-[4-[(3R)-piperidin-3-yl]phenyl]pyridine-2-carboxamide.
| Compound Name | 3,5-difluoro-N-[4-[(3R)-piperidin-3-yl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175718166 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3,5-difluoro-N-[4-[(3R)-piperidin-3-yl]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc([C@H]2CCCNC2)cc1)c1ncc(F)cc1F |
| InChI | InChI=1S/C17H17F2N3O/c18-13-8-15(19)16(21-10-13)17(23)22-14-5-3-11(4-6-14)12-2-1-7-20-9-12/h3-6,8,10,12,20H,1-2,7,9H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | SENVQIHIRZVRSQ-LBPRGKRZSA-N |
| XLogP | 3.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |