C17H21ClN4O — CID 67240535
5-methyl-N-(4-piperidin-3-ylphenyl)pyrazine-2-carboxamide;hydrochloride (PubChem CID 67240535) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 5-methyl-N-(4-piperidin-3-ylphenyl)pyrazine-2-carboxamide;hydrochloride.
| Compound Name | 5-methyl-N-(4-piperidin-3-ylphenyl)pyrazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67240535 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 5-methyl-N-(4-piperidin-3-ylphenyl)pyrazine-2-carboxamide;hydrochloride |
| SMILES | Cc1cnc(C(=O)Nc2ccc(C3CCCNC3)cc2)cn1.Cl |
| InChI | InChI=1S/C17H20N4O.ClH/c1-12-9-20-16(11-19-12)17(22)21-15-6-4-13(5-7-15)14-3-2-8-18-10-14;/h4-7,9,11,14,18H,2-3,8,10H2,1H3,(H,21,22);1H |
| InChIKey | MMDPQTVQCHLNSH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |