C24H28 — CID 143620439
(1Z,3E,5E,8Z,10E)-6-ethenyl-2,8,10-trimethyl-5-[(Z)-prop-1-enyl]bicyclo[9.5.0]hexadeca-1,3,5,8,10,13,15-heptaene (PubChem CID 143620439) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1Z,3E,5E,8Z,10E)-6-ethenyl-2,8,10-trimethyl-5-[(Z)-prop-1-enyl]bicyclo[9.5.0]hexadeca-1,3,5,8,10,13,15-heptaene.
| Compound Name | (1Z,3E,5E,8Z,10E)-6-ethenyl-2,8,10-trimethyl-5-[(Z)-prop-1-enyl]bicyclo[9.5.0]hexadeca-1,3,5,8,10,13,15-heptaene |
|---|---|
| PubChem CID | 143620439 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (1Z,3E,5E,8Z,10E)-6-ethenyl-2,8,10-trimethyl-5-[(Z)-prop-1-enyl]bicyclo[9.5.0]hexadeca-1,3,5,8,10,13,15-heptaene |
| SMILES | C=C/C1=C(\C=C/C)/C=C/C(C)=C2/C=CC=CC/C2=C(C)\C=C(\C)C1 |
| InChI | InChI=1S/C24H28/c1-6-11-22-15-14-19(4)23-12-9-8-10-13-24(23)20(5)16-18(3)17-21(22)7-2/h6-12,14-16H,2,13,17H2,1,3-5H3/b11-6-,15-14+,18-16-,22-21-,23-19-,24-20+ |
| InChIKey | PMOXBSFYVIUXIF-PQBCKLHNSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |